C8H2BrFO3 — CID 162731905
6-bromo-4-fluoro-2-benzofuran-1,3-dione (PubChem CID 162731905) has the molecular formula C8H2BrFO3 and a molecular weight of 245.00 g/mol. Its IUPAC name is 6-bromo-4-fluoro-2-benzofuran-1,3-dione.
| Compound Name | 6-bromo-4-fluoro-2-benzofuran-1,3-dione |
|---|---|
| PubChem CID | 162731905 |
| Molecular Formula | C8H2BrFO3 |
| Molecular Weight | 245.00 g/mol |
| Exact Mass | 243.92 |
| IUPAC Name | 6-bromo-4-fluoro-2-benzofuran-1,3-dione |
| SMILES | O=C1OC(=O)c2c(F)cc(Br)cc21 |
| InChI | InChI=1S/C8H2BrFO3/c9-3-1-4-6(5(10)2-3)8(12)13-7(4)11/h1-2H |
| InChIKey | GWNKFLHJVUBFLH-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.00 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|