C14H4F2O5 — CID 155048913
2,10-difluoro-6,13-dioxatetracyclo[6.6.2.04,16.011,15]hexadeca-1,3,8,10,15-pentaene-5,7,12-trione (PubChem CID 155048913) has the molecular formula C14H4F2O5 and a molecular weight of 290.18 g/mol. Its IUPAC name is 2,10-difluoro-6,13-dioxatetracyclo[6.6.2.04,16.011,15]hexadeca-1,3,8,10,15-pentaene-5,7,12-trione.
| Compound Name | 2,10-difluoro-6,13-dioxatetracyclo[6.6.2.04,16.011,15]hexadeca-1,3,8,10,15-pentaene-5,7,12-trione |
|---|---|
| PubChem CID | 155048913 |
| Molecular Formula | C14H4F2O5 |
| Molecular Weight | 290.18 g/mol |
| Exact Mass | 290.00 |
| IUPAC Name | 2,10-difluoro-6,13-dioxatetracyclo[6.6.2.04,16.011,15]hexadeca-1,3,8,10,15-pentaene-5,7,12-trione |
| SMILES | O=C1OC(=O)c2cc(F)c3c4c(c(F)cc1c24)COC3=O |
| InChI | InChI=1S/C14H4F2O5/c15-7-1-4-9-5(13(18)21-12(4)17)2-8(16)11-10(9)6(7)3-20-14(11)19/h1-2H,3H2 |
| InChIKey | YKXPSNMFDHEPPL-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.18 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|