C18H16ClF3N3O3P — CID 162734475
4-chloro-N-[ethoxy-[[4-[5-(trifluoromethyl)-1,3,4-oxadiazol-2-yl]phenyl]methyl]phosphoryl]aniline (PubChem CID 162734475) has the molecular formula C18H16ClF3N3O3P and a molecular weight of 445.77 g/mol. Its IUPAC name is 4-chloro-N-[ethoxy-[[4-[5-(trifluoromethyl)-1,3,4-oxadiazol-2-yl]phenyl]methyl]phosphoryl]aniline.
| Compound Name | 4-chloro-N-[ethoxy-[[4-[5-(trifluoromethyl)-1,3,4-oxadiazol-2-yl]phenyl]methyl]phosphoryl]aniline |
|---|---|
| PubChem CID | 162734475 |
| Molecular Formula | C18H16ClF3N3O3P |
| Molecular Weight | 445.77 g/mol |
| Exact Mass | 445.06 |
| IUPAC Name | 4-chloro-N-[ethoxy-[[4-[5-(trifluoromethyl)-1,3,4-oxadiazol-2-yl]phenyl]methyl]phosphoryl]aniline |
| SMILES | CCOP(=O)(Cc1ccc(-c2nnc(C(F)(F)F)o2)cc1)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H16ClF3N3O3P/c1-2-27-29(26,25-15-9-7-14(19)8-10-15)11-12-3-5-13(6-4-12)16-23-24-17(28-16)18(20,21)22/h3-10H,2,11H2,1H3,(H,25,26) |
| InChIKey | CDLACQIDGZGAMW-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 77.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.77 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|