C12H11BrN2O2 — CID 162737630
methyl 3-bromo-2,3-dihydro-1H-pyrrolo[1,2-a]benzimidazole-7-carboxylate (PubChem CID 162737630) has the molecular formula C12H11BrN2O2 and a molecular weight of 295.14 g/mol. Its IUPAC name is methyl 3-bromo-2,3-dihydro-1H-pyrrolo[1,2-a]benzimidazole-7-carboxylate.
| Compound Name | methyl 3-bromo-2,3-dihydro-1H-pyrrolo[1,2-a]benzimidazole-7-carboxylate |
|---|---|
| PubChem CID | 162737630 |
| Molecular Formula | C12H11BrN2O2 |
| Molecular Weight | 295.14 g/mol |
| Exact Mass | 294.00 |
| IUPAC Name | methyl 3-bromo-2,3-dihydro-1H-pyrrolo[1,2-a]benzimidazole-7-carboxylate |
| SMILES | COC(=O)c1ccc2nc3n(c2c1)CCC3Br |
| InChI | InChI=1S/C12H11BrN2O2/c1-17-12(16)7-2-3-9-10(6-7)15-5-4-8(13)11(15)14-9/h2-3,6,8H,4-5H2,1H3 |
| InChIKey | CQEYVCRWQORYPQ-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.14 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|