C16H18ClN2O3Si — CID 174010576
CID 174010576 (PubChem CID 174010576) has the molecular formula C16H18ClN2O3Si and a molecular weight of 349.87 g/mol.
| Compound Name | CID 174010576 |
|---|---|
| PubChem CID | 174010576 |
| Molecular Formula | C16H18ClN2O3Si |
| Molecular Weight | 349.87 g/mol |
| Exact Mass | 349.08 |
| IUPAC Name | — |
| SMILES | COC(=O)c1ccc2nc([C@H](C)Cl)n(CC([Si])[C@@H]3CCO3)c2c1 |
| InChI | InChI=1S/C16H18ClN2O3Si/c1-9(17)15-18-11-4-3-10(16(20)21-2)7-12(11)19(15)8-14(23)13-5-6-22-13/h3-4,7,9,13-14H,5-6,8H2,1-2H3/t9-,13-,14?/m0/s1 |
| InChIKey | UWOFZNZVKOCVKK-RFESSQRHSA-N |
| XLogP | 2.87 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.87 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|