C12H17N5O4 — CID 162739323
5-methyl-N-[2-oxo-2-[2-[[(3S)-2-oxopyrrolidin-3-yl]methyl]hydrazinyl]ethyl]-1,2-oxazole-3-carboxamide (PubChem CID 162739323) has the molecular formula C12H17N5O4 and a molecular weight of 295.30 g/mol. Its IUPAC name is 5-methyl-N-[2-oxo-2-[2-[[(3S)-2-oxopyrrolidin-3-yl]methyl]hydrazinyl]ethyl]-1,2-oxazole-3-carboxamide.
| Compound Name | 5-methyl-N-[2-oxo-2-[2-[[(3S)-2-oxopyrrolidin-3-yl]methyl]hydrazinyl]ethyl]-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 162739323 |
| Molecular Formula | C12H17N5O4 |
| Molecular Weight | 295.30 g/mol |
| Exact Mass | 295.13 |
| IUPAC Name | 5-methyl-N-[2-oxo-2-[2-[[(3S)-2-oxopyrrolidin-3-yl]methyl]hydrazinyl]ethyl]-1,2-oxazole-3-carboxamide |
| SMILES | Cc1cc(C(=O)NCC(=O)NNC[C@@H]2CCNC2=O)no1 |
| InChI | InChI=1S/C12H17N5O4/c1-7-4-9(17-21-7)12(20)14-6-10(18)16-15-5-8-2-3-13-11(8)19/h4,8,15H,2-3,5-6H2,1H3,(H,13,19)(H,14,20)(H,16,18)/t8-/m0/s1 |
| InChIKey | OIFJSSSFWHGCTH-QMMMGPOBSA-N |
| XLogP | -1.53 |
| TPSA | 125.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.30 |
| LogP ≤ 5 | -1.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|