C24H28IN5S — CID 162740305
ethane;4-[[2-methylidene-1-(5-pyridin-4-yl-1H-pyrazol-3-yl)piperidin-3-yl]methyl]benzonitrile;thiohypoiodous acid (PubChem CID 162740305) has the molecular formula C24H28IN5S and a molecular weight of 545.49 g/mol. Its IUPAC name is ethane;4-[[2-methylidene-1-(5-pyridin-4-yl-1H-pyrazol-3-yl)piperidin-3-yl]methyl]benzonitrile;thiohypoiodous acid.
| Compound Name | ethane;4-[[2-methylidene-1-(5-pyridin-4-yl-1H-pyrazol-3-yl)piperidin-3-yl]methyl]benzonitrile;thiohypoiodous acid |
|---|---|
| PubChem CID | 162740305 |
| Molecular Formula | C24H28IN5S |
| Molecular Weight | 545.49 g/mol |
| Exact Mass | 545.11 |
| IUPAC Name | ethane;4-[[2-methylidene-1-(5-pyridin-4-yl-1H-pyrazol-3-yl)piperidin-3-yl]methyl]benzonitrile;thiohypoiodous acid |
| SMILES | C=C1C(Cc2ccc(C#N)cc2)CCCN1c1cc(-c2ccncc2)[nH]n1.CC.SI |
| InChI | InChI=1S/C22H21N5.C2H6.HIS/c1-16-20(13-17-4-6-18(15-23)7-5-17)3-2-12-27(16)22-14-21(25-26-22)19-8-10-24-11-9-19;2*1-2/h4-11,14,20H,1-3,12-13H2,(H,25,26);1-2H3;2H |
| InChIKey | LTWBNVIHFQGQRW-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 68.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.49 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|