C22H42N6 — CID 162741933
5-piperidin-4-yl-2,5-diazaspiro[3.4]octane (PubChem CID 162741933) has the molecular formula C22H42N6 and a molecular weight of 390.62 g/mol. Its IUPAC name is 5-piperidin-4-yl-2,5-diazaspiro[3.4]octane.
| Compound Name | 5-piperidin-4-yl-2,5-diazaspiro[3.4]octane |
|---|---|
| PubChem CID | 162741933 |
| Molecular Formula | C22H42N6 |
| Molecular Weight | 390.62 g/mol |
| Exact Mass | 390.35 |
| IUPAC Name | 5-piperidin-4-yl-2,5-diazaspiro[3.4]octane |
| SMILES | C1CN(C2CCNCC2)C2(C1)CNC2.C1CN(C2CCNCC2)C2(C1)CNC2 |
| InChI | InChI=1S/2C11H21N3/c2*1-4-11(8-13-9-11)14(7-1)10-2-5-12-6-3-10/h2*10,12-13H,1-9H2 |
| InChIKey | IIKWICXFSIWXFE-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 54.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.62 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |