C14H23N3O3 — CID 162747953
tert-butyl 4-(3-cyanooxolan-3-yl)piperazine-1-carboxylate (PubChem CID 162747953) has the molecular formula C14H23N3O3 and a molecular weight of 281.36 g/mol. Its IUPAC name is tert-butyl 4-(3-cyanooxolan-3-yl)piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-(3-cyanooxolan-3-yl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 162747953 |
| Molecular Formula | C14H23N3O3 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.17 |
| IUPAC Name | tert-butyl 4-(3-cyanooxolan-3-yl)piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(C2(C#N)CCOC2)CC1 |
| InChI | InChI=1S/C14H23N3O3/c1-13(2,3)20-12(18)16-5-7-17(8-6-16)14(10-15)4-9-19-11-14/h4-9,11H2,1-3H3 |
| InChIKey | GAHCOPJWRCFWLU-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 65.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |