C21H28Cl2N4O2 — CID 162750139
6,8-dichloro-N-hexyl-4-(1H-pyrazol-4-yl)quinolin-2-amine;ethane;formic acid (PubChem CID 162750139) has the molecular formula C21H28Cl2N4O2 and a molecular weight of 439.39 g/mol. Its IUPAC name is 6,8-dichloro-N-hexyl-4-(1H-pyrazol-4-yl)quinolin-2-amine;ethane;formic acid.
| Compound Name | 6,8-dichloro-N-hexyl-4-(1H-pyrazol-4-yl)quinolin-2-amine;ethane;formic acid |
|---|---|
| PubChem CID | 162750139 |
| Molecular Formula | C21H28Cl2N4O2 |
| Molecular Weight | 439.39 g/mol |
| Exact Mass | 438.16 |
| IUPAC Name | 6,8-dichloro-N-hexyl-4-(1H-pyrazol-4-yl)quinolin-2-amine;ethane;formic acid |
| SMILES | CC.CCCCCCNc1cc(-c2cn[nH]c2)c2cc(Cl)cc(Cl)c2n1.O=CO |
| InChI | InChI=1S/C18H20Cl2N4.C2H6.CH2O2/c1-2-3-4-5-6-21-17-9-14(12-10-22-23-11-12)15-7-13(19)8-16(20)18(15)24-17;1-2;2-1-3/h7-11H,2-6H2,1H3,(H,21,24)(H,22,23);1-2H3;1H,(H,2,3) |
| InChIKey | GWWVNZRLGJDLAD-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.39 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|