C21H20Cl2N4O3 — CID 162750586
3-[[2-(7,8-dichloro-4-imidazol-1-ylquinolin-2-yl)-2-azabicyclo[2.1.1]hexan-1-yl]methoxy]propanoic acid (PubChem CID 162750586) has the molecular formula C21H20Cl2N4O3 and a molecular weight of 447.32 g/mol. Its IUPAC name is 3-[[2-(7,8-dichloro-4-imidazol-1-ylquinolin-2-yl)-2-azabicyclo[2.1.1]hexan-1-yl]methoxy]propanoic acid.
| Compound Name | 3-[[2-(7,8-dichloro-4-imidazol-1-ylquinolin-2-yl)-2-azabicyclo[2.1.1]hexan-1-yl]methoxy]propanoic acid |
|---|---|
| PubChem CID | 162750586 |
| Molecular Formula | C21H20Cl2N4O3 |
| Molecular Weight | 447.32 g/mol |
| Exact Mass | 446.09 |
| IUPAC Name | 3-[[2-(7,8-dichloro-4-imidazol-1-ylquinolin-2-yl)-2-azabicyclo[2.1.1]hexan-1-yl]methoxy]propanoic acid |
| SMILES | O=C(O)CCOCC12CC(CN1c1cc(-n3ccnc3)c3ccc(Cl)c(Cl)c3n1)C2 |
| InChI | InChI=1S/C21H20Cl2N4O3/c22-15-2-1-14-16(26-5-4-24-12-26)7-17(25-20(14)19(15)23)27-10-13-8-21(27,9-13)11-30-6-3-18(28)29/h1-2,4-5,7,12-13H,3,6,8-11H2,(H,28,29) |
| InChIKey | XCVIMTMAUPGARY-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.32 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|