C18H18Cl2N4O3 — CID 162750476
3-[3-[(7,8-dichloro-4-imidazol-1-ylquinolin-2-yl)amino]propoxy]propanoic acid (PubChem CID 162750476) has the molecular formula C18H18Cl2N4O3 and a molecular weight of 409.27 g/mol. Its IUPAC name is 3-[3-[(7,8-dichloro-4-imidazol-1-ylquinolin-2-yl)amino]propoxy]propanoic acid.
| Compound Name | 3-[3-[(7,8-dichloro-4-imidazol-1-ylquinolin-2-yl)amino]propoxy]propanoic acid |
|---|---|
| PubChem CID | 162750476 |
| Molecular Formula | C18H18Cl2N4O3 |
| Molecular Weight | 409.27 g/mol |
| Exact Mass | 408.08 |
| IUPAC Name | 3-[3-[(7,8-dichloro-4-imidazol-1-ylquinolin-2-yl)amino]propoxy]propanoic acid |
| SMILES | O=C(O)CCOCCCNc1cc(-n2ccnc2)c2ccc(Cl)c(Cl)c2n1 |
| InChI | InChI=1S/C18H18Cl2N4O3/c19-13-3-2-12-14(24-7-6-21-11-24)10-15(23-18(12)17(13)20)22-5-1-8-27-9-4-16(25)26/h2-3,6-7,10-11H,1,4-5,8-9H2,(H,22,23)(H,25,26) |
| InChIKey | AOOQNBAOGYFTOJ-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.27 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|