C14H13Cl2N4O3P — CID 162750991
2-[(7,8-dichloro-4-imidazol-1-ylquinolin-2-yl)amino]ethylphosphonic acid (PubChem CID 162750991) has the molecular formula C14H13Cl2N4O3P and a molecular weight of 387.16 g/mol. Its IUPAC name is 2-[(7,8-dichloro-4-imidazol-1-ylquinolin-2-yl)amino]ethylphosphonic acid.
| Compound Name | 2-[(7,8-dichloro-4-imidazol-1-ylquinolin-2-yl)amino]ethylphosphonic acid |
|---|---|
| PubChem CID | 162750991 |
| Molecular Formula | C14H13Cl2N4O3P |
| Molecular Weight | 387.16 g/mol |
| Exact Mass | 386.01 |
| IUPAC Name | 2-[(7,8-dichloro-4-imidazol-1-ylquinolin-2-yl)amino]ethylphosphonic acid |
| SMILES | O=P(O)(O)CCNc1cc(-n2ccnc2)c2ccc(Cl)c(Cl)c2n1 |
| InChI | InChI=1S/C14H13Cl2N4O3P/c15-10-2-1-9-11(20-5-3-17-8-20)7-12(19-14(9)13(10)16)18-4-6-24(21,22)23/h1-3,5,7-8H,4,6H2,(H,18,19)(H2,21,22,23) |
| InChIKey | XRAVRKHZOOUCML-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 100.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.16 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|