C18H18Cl2N4O2 — CID 162751052
6-[(7,8-dichloro-4-imidazol-1-ylquinolin-2-yl)amino]hexanoic acid (PubChem CID 162751052) has the molecular formula C18H18Cl2N4O2 and a molecular weight of 393.27 g/mol. Its IUPAC name is 6-[(7,8-dichloro-4-imidazol-1-ylquinolin-2-yl)amino]hexanoic acid.
| Compound Name | 6-[(7,8-dichloro-4-imidazol-1-ylquinolin-2-yl)amino]hexanoic acid |
|---|---|
| PubChem CID | 162751052 |
| Molecular Formula | C18H18Cl2N4O2 |
| Molecular Weight | 393.27 g/mol |
| Exact Mass | 392.08 |
| IUPAC Name | 6-[(7,8-dichloro-4-imidazol-1-ylquinolin-2-yl)amino]hexanoic acid |
| SMILES | O=C(O)CCCCCNc1cc(-n2ccnc2)c2ccc(Cl)c(Cl)c2n1 |
| InChI | InChI=1S/C18H18Cl2N4O2/c19-13-6-5-12-14(24-9-8-21-11-24)10-15(23-18(12)17(13)20)22-7-3-1-2-4-16(25)26/h5-6,8-11H,1-4,7H2,(H,22,23)(H,25,26) |
| InChIKey | IIMFVVMUUFMXML-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.27 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|