C16H14Cl2N4O2 — CID 162750197
(3S)-3-[(7,8-dichloro-4-imidazol-1-ylquinolin-2-yl)amino]butanoic acid (PubChem CID 162750197) has the molecular formula C16H14Cl2N4O2 and a molecular weight of 365.22 g/mol. Its IUPAC name is (3S)-3-[(7,8-dichloro-4-imidazol-1-ylquinolin-2-yl)amino]butanoic acid.
| Compound Name | (3S)-3-[(7,8-dichloro-4-imidazol-1-ylquinolin-2-yl)amino]butanoic acid |
|---|---|
| PubChem CID | 162750197 |
| Molecular Formula | C16H14Cl2N4O2 |
| Molecular Weight | 365.22 g/mol |
| Exact Mass | 364.05 |
| IUPAC Name | (3S)-3-[(7,8-dichloro-4-imidazol-1-ylquinolin-2-yl)amino]butanoic acid |
| SMILES | C[C@@H](CC(=O)O)Nc1cc(-n2ccnc2)c2ccc(Cl)c(Cl)c2n1 |
| InChI | InChI=1S/C16H14Cl2N4O2/c1-9(6-14(23)24)20-13-7-12(22-5-4-19-8-22)10-2-3-11(17)15(18)16(10)21-13/h2-5,7-9H,6H2,1H3,(H,20,21)(H,23,24)/t9-/m0/s1 |
| InChIKey | XBIRLTIXFKODIU-VIFPVBQESA-N |
| XLogP | 4.00 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.22 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |