C26H30Cl2N4O3 — CID 174164762
3-[[(2S)-4-cyclohexyl-1-(7,8-dichloro-4-imidazol-1-ylquinolin-2-yl)pyrrolidin-2-yl]methoxy]propanoic acid (PubChem CID 174164762) has the molecular formula C26H30Cl2N4O3 and a molecular weight of 517.46 g/mol. Its IUPAC name is 3-[[(2S)-4-cyclohexyl-1-(7,8-dichloro-4-imidazol-1-ylquinolin-2-yl)pyrrolidin-2-yl]methoxy]propanoic acid.
| Compound Name | 3-[[(2S)-4-cyclohexyl-1-(7,8-dichloro-4-imidazol-1-ylquinolin-2-yl)pyrrolidin-2-yl]methoxy]propanoic acid |
|---|---|
| PubChem CID | 174164762 |
| Molecular Formula | C26H30Cl2N4O3 |
| Molecular Weight | 517.46 g/mol |
| Exact Mass | 516.17 |
| IUPAC Name | 3-[[(2S)-4-cyclohexyl-1-(7,8-dichloro-4-imidazol-1-ylquinolin-2-yl)pyrrolidin-2-yl]methoxy]propanoic acid |
| SMILES | O=C(O)CCOC[C@@H]1CC(C2CCCCC2)CN1c1cc(-n2ccnc2)c2ccc(Cl)c(Cl)c2n1 |
| InChI | InChI=1S/C26H30Cl2N4O3/c27-21-7-6-20-22(31-10-9-29-16-31)13-23(30-26(20)25(21)28)32-14-18(17-4-2-1-3-5-17)12-19(32)15-35-11-8-24(33)34/h6-7,9-10,13,16-19H,1-5,8,11-12,14-15H2,(H,33,34)/t18?,19-/m0/s1 |
| InChIKey | HIXSREJOBWMZLH-GGYWPGCISA-N |
| XLogP | 5.99 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.46 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|