C23H29Cl2N4O4P — CID 167396123
7,8-dichloro-2-[(2S)-2-(2-diethoxyphosphorylethoxymethyl)pyrrolidin-1-yl]-4-imidazol-1-ylquinoline (PubChem CID 167396123) has the molecular formula C23H29Cl2N4O4P and a molecular weight of 527.39 g/mol. Its IUPAC name is 7,8-dichloro-2-[(2S)-2-(2-diethoxyphosphorylethoxymethyl)pyrrolidin-1-yl]-4-imidazol-1-ylquinoline.
| Compound Name | 7,8-dichloro-2-[(2S)-2-(2-diethoxyphosphorylethoxymethyl)pyrrolidin-1-yl]-4-imidazol-1-ylquinoline |
|---|---|
| PubChem CID | 167396123 |
| Molecular Formula | C23H29Cl2N4O4P |
| Molecular Weight | 527.39 g/mol |
| Exact Mass | 526.13 |
| IUPAC Name | 7,8-dichloro-2-[(2S)-2-(2-diethoxyphosphorylethoxymethyl)pyrrolidin-1-yl]-4-imidazol-1-ylquinoline |
| SMILES | CCOP(=O)(CCOC[C@@H]1CCCN1c1cc(-n2ccnc2)c2ccc(Cl)c(Cl)c2n1)OCC |
| InChI | InChI=1S/C23H29Cl2N4O4P/c1-3-32-34(30,33-4-2)13-12-31-15-17-6-5-10-29(17)21-14-20(28-11-9-26-16-28)18-7-8-19(24)22(25)23(18)27-21/h7-9,11,14,16-17H,3-6,10,12-13,15H2,1-2H3/t17-/m0/s1 |
| InChIKey | LOEVOPZEXLHAJH-KRWDZBQOSA-N |
| XLogP | 5.98 |
| TPSA | 78.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.39 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|