C25H30Cl2N4O3 — CID 162751128
tert-butyl 3-[[(2S)-1-[7,8-dichloro-4-(4-methylimidazol-1-yl)quinolin-2-yl]pyrrolidin-2-yl]methoxy]propanoate (PubChem CID 162751128) has the molecular formula C25H30Cl2N4O3 and a molecular weight of 505.45 g/mol. Its IUPAC name is tert-butyl 3-[[(2S)-1-[7,8-dichloro-4-(4-methylimidazol-1-yl)quinolin-2-yl]pyrrolidin-2-yl]methoxy]propanoate.
| Compound Name | tert-butyl 3-[[(2S)-1-[7,8-dichloro-4-(4-methylimidazol-1-yl)quinolin-2-yl]pyrrolidin-2-yl]methoxy]propanoate |
|---|---|
| PubChem CID | 162751128 |
| Molecular Formula | C25H30Cl2N4O3 |
| Molecular Weight | 505.45 g/mol |
| Exact Mass | 504.17 |
| IUPAC Name | tert-butyl 3-[[(2S)-1-[7,8-dichloro-4-(4-methylimidazol-1-yl)quinolin-2-yl]pyrrolidin-2-yl]methoxy]propanoate |
| SMILES | Cc1cn(-c2cc(N3CCC[C@H]3COCCC(=O)OC(C)(C)C)nc3c(Cl)c(Cl)ccc23)cn1 |
| InChI | InChI=1S/C25H30Cl2N4O3/c1-16-13-30(15-28-16)20-12-21(29-24-18(20)7-8-19(26)23(24)27)31-10-5-6-17(31)14-33-11-9-22(32)34-25(2,3)4/h7-8,12-13,15,17H,5-6,9-11,14H2,1-4H3/t17-/m0/s1 |
| InChIKey | KHBUPHILQUMNDW-KRWDZBQOSA-N |
| XLogP | 5.75 |
| TPSA | 69.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.45 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|