C21H25BrCl2N2O3 — CID 169177507
tert-butyl 3-[[(2S)-1-(4-bromo-7,8-dichloroquinolin-2-yl)pyrrolidin-2-yl]methoxy]propanoate (PubChem CID 169177507) has the molecular formula C21H25BrCl2N2O3 and a molecular weight of 504.25 g/mol. Its IUPAC name is tert-butyl 3-[[(2S)-1-(4-bromo-7,8-dichloroquinolin-2-yl)pyrrolidin-2-yl]methoxy]propanoate.
| Compound Name | tert-butyl 3-[[(2S)-1-(4-bromo-7,8-dichloroquinolin-2-yl)pyrrolidin-2-yl]methoxy]propanoate |
|---|---|
| PubChem CID | 169177507 |
| Molecular Formula | C21H25BrCl2N2O3 |
| Molecular Weight | 504.25 g/mol |
| Exact Mass | 502.04 |
| IUPAC Name | tert-butyl 3-[[(2S)-1-(4-bromo-7,8-dichloroquinolin-2-yl)pyrrolidin-2-yl]methoxy]propanoate |
| SMILES | CC(C)(C)OC(=O)CCOC[C@@H]1CCCN1c1cc(Br)c2ccc(Cl)c(Cl)c2n1 |
| InChI | InChI=1S/C21H25BrCl2N2O3/c1-21(2,3)29-18(27)8-10-28-12-13-5-4-9-26(13)17-11-15(22)14-6-7-16(23)19(24)20(14)25-17/h6-7,11,13H,4-5,8-10,12H2,1-3H3/t13-/m0/s1 |
| InChIKey | RMLJEABVZQJUPU-ZDUSSCGKSA-N |
| XLogP | 6.02 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.25 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|