C19H18BrCl2N5O3 — CID 169177421
3-[[(2R)-1-[6-bromo-7,8-dichloro-4-(1,2,4-triazol-1-yl)quinolin-2-yl]pyrrolidin-2-yl]methoxy]propanoic acid (PubChem CID 169177421) has the molecular formula C19H18BrCl2N5O3 and a molecular weight of 515.20 g/mol. Its IUPAC name is 3-[[(2R)-1-[6-bromo-7,8-dichloro-4-(1,2,4-triazol-1-yl)quinolin-2-yl]pyrrolidin-2-yl]methoxy]propanoic acid.
| Compound Name | 3-[[(2R)-1-[6-bromo-7,8-dichloro-4-(1,2,4-triazol-1-yl)quinolin-2-yl]pyrrolidin-2-yl]methoxy]propanoic acid |
|---|---|
| PubChem CID | 169177421 |
| Molecular Formula | C19H18BrCl2N5O3 |
| Molecular Weight | 515.20 g/mol |
| Exact Mass | 513.00 |
| IUPAC Name | 3-[[(2R)-1-[6-bromo-7,8-dichloro-4-(1,2,4-triazol-1-yl)quinolin-2-yl]pyrrolidin-2-yl]methoxy]propanoic acid |
| SMILES | O=C(O)CCOC[C@H]1CCCN1c1cc(-n2cncn2)c2cc(Br)c(Cl)c(Cl)c2n1 |
| InChI | InChI=1S/C19H18BrCl2N5O3/c20-13-6-12-14(27-10-23-9-24-27)7-15(25-19(12)18(22)17(13)21)26-4-1-2-11(26)8-30-5-3-16(28)29/h6-7,9-11H,1-5,8H2,(H,28,29)/t11-/m1/s1 |
| InChIKey | HBPCFZVWCHJXKD-LLVKDONJSA-N |
| XLogP | 4.34 |
| TPSA | 93.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.20 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|