C22H27Cl2N3O4 — CID 162750744
methyl 3-[[(2S)-1-[7,8-dichloro-4-[(3R)-3-hydroxypyrrolidin-1-yl]quinolin-2-yl]pyrrolidin-2-yl]methoxy]propanoate (PubChem CID 162750744) has the molecular formula C22H27Cl2N3O4 and a molecular weight of 468.38 g/mol. Its IUPAC name is methyl 3-[[(2S)-1-[7,8-dichloro-4-[(3R)-3-hydroxypyrrolidin-1-yl]quinolin-2-yl]pyrrolidin-2-yl]methoxy]propanoate.
| Compound Name | methyl 3-[[(2S)-1-[7,8-dichloro-4-[(3R)-3-hydroxypyrrolidin-1-yl]quinolin-2-yl]pyrrolidin-2-yl]methoxy]propanoate |
|---|---|
| PubChem CID | 162750744 |
| Molecular Formula | C22H27Cl2N3O4 |
| Molecular Weight | 468.38 g/mol |
| Exact Mass | 467.14 |
| IUPAC Name | methyl 3-[[(2S)-1-[7,8-dichloro-4-[(3R)-3-hydroxypyrrolidin-1-yl]quinolin-2-yl]pyrrolidin-2-yl]methoxy]propanoate |
| SMILES | COC(=O)CCOC[C@@H]1CCCN1c1cc(N2CC[C@@H](O)C2)c2ccc(Cl)c(Cl)c2n1 |
| InChI | InChI=1S/C22H27Cl2N3O4/c1-30-20(29)7-10-31-13-14-3-2-8-27(14)19-11-18(26-9-6-15(28)12-26)16-4-5-17(23)21(24)22(16)25-19/h4-5,11,14-15,28H,2-3,6-10,12-13H2,1H3/t14-,15+/m0/s1 |
| InChIKey | DMDJEEYADPJVAB-LSDHHAIUSA-N |
| XLogP | 3.66 |
| TPSA | 75.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.38 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|