C23H28BrN5O3 — CID 170366910
tert-butyl 3-[[(2S)-1-[7-bromo-4-(1H-1,2,4-triazol-5-yl)quinolin-2-yl]pyrrolidin-2-yl]methoxy]propanoate (PubChem CID 170366910) has the molecular formula C23H28BrN5O3 and a molecular weight of 502.41 g/mol. Its IUPAC name is tert-butyl 3-[[(2S)-1-[7-bromo-4-(1H-1,2,4-triazol-5-yl)quinolin-2-yl]pyrrolidin-2-yl]methoxy]propanoate.
| Compound Name | tert-butyl 3-[[(2S)-1-[7-bromo-4-(1H-1,2,4-triazol-5-yl)quinolin-2-yl]pyrrolidin-2-yl]methoxy]propanoate |
|---|---|
| PubChem CID | 170366910 |
| Molecular Formula | C23H28BrN5O3 |
| Molecular Weight | 502.41 g/mol |
| Exact Mass | 501.14 |
| IUPAC Name | tert-butyl 3-[[(2S)-1-[7-bromo-4-(1H-1,2,4-triazol-5-yl)quinolin-2-yl]pyrrolidin-2-yl]methoxy]propanoate |
| SMILES | CC(C)(C)OC(=O)CCOC[C@@H]1CCCN1c1cc(-c2ncn[nH]2)c2ccc(Br)cc2n1 |
| InChI | InChI=1S/C23H28BrN5O3/c1-23(2,3)32-21(30)8-10-31-13-16-5-4-9-29(16)20-12-18(22-25-14-26-28-22)17-7-6-15(24)11-19(17)27-20/h6-7,11-12,14,16H,4-5,8-10,13H2,1-3H3,(H,25,26,28)/t16-/m0/s1 |
| InChIKey | UNFQCLVARFWBNM-INIZCTEOSA-N |
| XLogP | 4.50 |
| TPSA | 93.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.41 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|