C21H31N3O8 — CID 162756028
(2,5-dioxopyrrolidin-1-yl) 3-[3-[[3-(2,5-dioxopyrrol-1-yl)-1-hydroxypropyl]amino]-2,2-dimethylpropoxy]-2,2-dimethylpropanoate (PubChem CID 162756028) has the molecular formula C21H31N3O8 and a molecular weight of 453.49 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 3-[3-[[3-(2,5-dioxopyrrol-1-yl)-1-hydroxypropyl]amino]-2,2-dimethylpropoxy]-2,2-dimethylpropanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 3-[3-[[3-(2,5-dioxopyrrol-1-yl)-1-hydroxypropyl]amino]-2,2-dimethylpropoxy]-2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 162756028 |
| Molecular Formula | C21H31N3O8 |
| Molecular Weight | 453.49 g/mol |
| Exact Mass | 453.21 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 3-[3-[[3-(2,5-dioxopyrrol-1-yl)-1-hydroxypropyl]amino]-2,2-dimethylpropoxy]-2,2-dimethylpropanoate |
| SMILES | CC(C)(CNC(O)CCN1C(=O)C=CC1=O)COCC(C)(C)C(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C21H31N3O8/c1-20(2,11-22-14(25)9-10-23-15(26)5-6-16(23)27)12-31-13-21(3,4)19(30)32-24-17(28)7-8-18(24)29/h5-6,14,22,25H,7-13H2,1-4H3 |
| InChIKey | CRGKDPUDQBEIOE-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 142.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.49 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|