C18H14FNO2S — CID 162757092
4-[3-(2,4-dimethyl-1,3-thiazol-5-yl)-2-fluorophenyl]benzoic acid (PubChem CID 162757092) has the molecular formula C18H14FNO2S and a molecular weight of 327.38 g/mol. Its IUPAC name is 4-[3-(2,4-dimethyl-1,3-thiazol-5-yl)-2-fluorophenyl]benzoic acid.
| Compound Name | 4-[3-(2,4-dimethyl-1,3-thiazol-5-yl)-2-fluorophenyl]benzoic acid |
|---|---|
| PubChem CID | 162757092 |
| Molecular Formula | C18H14FNO2S |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.07 |
| IUPAC Name | 4-[3-(2,4-dimethyl-1,3-thiazol-5-yl)-2-fluorophenyl]benzoic acid |
| SMILES | Cc1nc(C)c(-c2cccc(-c3ccc(C(=O)O)cc3)c2F)s1 |
| InChI | InChI=1S/C18H14FNO2S/c1-10-17(23-11(2)20-10)15-5-3-4-14(16(15)19)12-6-8-13(9-7-12)18(21)22/h3-9H,1-2H3,(H,21,22) |
| InChIKey | MPSRRXYOQCVEDM-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |