C22H19F3N4O3S — CID 162757379
4-[6-[2-[[(1E,3Z)-1,4-diamino-5,5,5-trifluoropenta-1,3-dienoxy]methyl]-4-methyl-1,3-thiazol-5-yl]-2-pyridinyl]benzoic acid (PubChem CID 162757379) has the molecular formula C22H19F3N4O3S and a molecular weight of 476.48 g/mol. Its IUPAC name is 4-[6-[2-[[(1E,3Z)-1,4-diamino-5,5,5-trifluoropenta-1,3-dienoxy]methyl]-4-methyl-1,3-thiazol-5-yl]-2-pyridinyl]benzoic acid.
| Compound Name | 4-[6-[2-[[(1E,3Z)-1,4-diamino-5,5,5-trifluoropenta-1,3-dienoxy]methyl]-4-methyl-1,3-thiazol-5-yl]-2-pyridinyl]benzoic acid |
|---|---|
| PubChem CID | 162757379 |
| Molecular Formula | C22H19F3N4O3S |
| Molecular Weight | 476.48 g/mol |
| Exact Mass | 476.11 |
| IUPAC Name | 4-[6-[2-[[(1E,3Z)-1,4-diamino-5,5,5-trifluoropenta-1,3-dienoxy]methyl]-4-methyl-1,3-thiazol-5-yl]-2-pyridinyl]benzoic acid |
| SMILES | Cc1nc(CO/C(N)=C/C=C(\N)C(F)(F)F)sc1-c1cccc(-c2ccc(C(=O)O)cc2)n1 |
| InChI | InChI=1S/C22H19F3N4O3S/c1-12-20(33-19(28-12)11-32-18(27)10-9-17(26)22(23,24)25)16-4-2-3-15(29-16)13-5-7-14(8-6-13)21(30)31/h2-10H,11,26-27H2,1H3,(H,30,31)/b17-9-,18-10+ |
| InChIKey | TWELZDXVIZMHSG-BUOZRGFLSA-N |
| XLogP | 4.60 |
| TPSA | 124.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.48 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|