C12H18BF2N3O2S — CID 162757723
[N,2-diamino-3-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)anilino] thiohypofluorite (PubChem CID 162757723) has the molecular formula C12H18BF2N3O2S and a molecular weight of 317.17 g/mol. Its IUPAC name is [N,2-diamino-3-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)anilino] thiohypofluorite.
| Compound Name | [N,2-diamino-3-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)anilino] thiohypofluorite |
|---|---|
| PubChem CID | 162757723 |
| Molecular Formula | C12H18BF2N3O2S |
| Molecular Weight | 317.17 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | [N,2-diamino-3-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)anilino] thiohypofluorite |
| SMILES | CC1(C)OB(c2cc(F)c(N)c(N(N)SF)c2)OC1(C)C |
| InChI | InChI=1S/C12H18BF2N3O2S/c1-11(2)12(3,4)20-13(19-11)7-5-8(14)10(16)9(6-7)18(17)21-15/h5-6H,16-17H2,1-4H3 |
| InChIKey | NJEYKLJFKHBHDP-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 73.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.17 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|