C11H16N3O3Pd- — CID 162757896
2-[2-imidazol-3-id-4-ylethyl(methyl)carbamoyl]butanoic acid;palladium (PubChem CID 162757896) has the molecular formula C11H16N3O3Pd- and a molecular weight of 344.69 g/mol. Its IUPAC name is 2-[2-imidazol-3-id-4-ylethyl(methyl)carbamoyl]butanoic acid;palladium.
| Compound Name | 2-[2-imidazol-3-id-4-ylethyl(methyl)carbamoyl]butanoic acid;palladium |
|---|---|
| PubChem CID | 162757896 |
| Molecular Formula | C11H16N3O3Pd- |
| Molecular Weight | 344.69 g/mol |
| Exact Mass | 344.02 |
| IUPAC Name | 2-[2-imidazol-3-id-4-ylethyl(methyl)carbamoyl]butanoic acid;palladium |
| SMILES | CCC(C(=O)O)C(=O)N(C)CCc1cnc[n-]1.[Pd] |
| InChI | InChI=1S/C11H17N3O3.Pd/c1-3-9(11(16)17)10(15)14(2)5-4-8-6-12-7-13-8;/h6-7,9H,3-5H2,1-2H3,(H2,12,13,16,17);/p-1 |
| InChIKey | TVODNVHCBJPWGL-UHFFFAOYSA-M |
| XLogP | 0.15 |
| TPSA | 84.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.69 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|