About tert-butyl cyclopropanecarboxylate;ethane;1-methylimidazole
tert-butyl cyclopropanecarboxylate;ethane;1-methylimidazole (PubChem CID 162764253) has the molecular formula C14H26N2O2
and a molecular weight of 254.37 g/mol. Its IUPAC name is tert-butyl cyclopropanecarboxylate;ethane;1-methylimidazole.
Molecular Properties
| Compound Name | tert-butyl cyclopropanecarboxylate;ethane;1-methylimidazole |
| PubChem CID | 162764253 |
| Molecular Formula | C14H26N2O2 |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.20 |
| IUPAC Name | tert-butyl cyclopropanecarboxylate;ethane;1-methylimidazole |
| SMILES | CC.CC(C)(C)OC(=O)C1CC1.Cn1ccnc1 |
| InChI | InChI=1S/C8H14O2.C4H6N2.C2H6/c1-8(2,3)10-7(9)6-4-5-6;1-6-3-2-5-4-6;1-2/h6H,4-5H2,1-3H3;2-4H,1H3;1-2H3 |
| InChIKey | LGDHJQLAVAJHHW-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze tert-butyl cyclopropanecarboxylate;ethane;1-methylimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl cyclopropanecarboxylate;ethane;1-methylimidazole?
The IUPAC name of tert-butyl cyclopropanecarboxylate;ethane;1-methylimidazole (CID 162764253) is tert-butyl cyclopropanecarboxylate;ethane;1-methylimidazole.
What is the SMILES notation for tert-butyl cyclopropanecarboxylate;ethane;1-methylimidazole?
The canonical SMILES for tert-butyl cyclopropanecarboxylate;ethane;1-methylimidazole is CC.CC(C)(C)OC(=O)C1CC1.Cn1ccnc1.
What is the InChIKey of tert-butyl cyclopropanecarboxylate;ethane;1-methylimidazole?
The InChIKey is LGDHJQLAVAJHHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14O2.C4H6N2.C2H6/c1-8(2,3)10-7(9)6-4-5-6;1-6-3-2-5-4-6;1-2/h6H,4-5H2,1-3H3;2-4H,1H3;1-2H3.
What are the key properties of tert-butyl cyclopropanecarboxylate;ethane;1-methylimidazole?
tert-butyl cyclopropanecarboxylate;ethane;1-methylimidazole has a molecular weight of 254.37 g/mol, XLogP of 3.18, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl cyclopropanecarboxylate;ethane;1-methylimidazole is sourced from PubChem (CID 162764253), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).