C21H32N4O4 — CID 177238633
tert-butyl 5-formamido-6-methoxy-1,3-dihydroisoindole-2-carboxylate;ethane;1-methylimidazole (PubChem CID 177238633) has the molecular formula C21H32N4O4 and a molecular weight of 404.51 g/mol. Its IUPAC name is tert-butyl 5-formamido-6-methoxy-1,3-dihydroisoindole-2-carboxylate;ethane;1-methylimidazole.
| Compound Name | tert-butyl 5-formamido-6-methoxy-1,3-dihydroisoindole-2-carboxylate;ethane;1-methylimidazole |
|---|---|
| PubChem CID | 177238633 |
| Molecular Formula | C21H32N4O4 |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.24 |
| IUPAC Name | tert-butyl 5-formamido-6-methoxy-1,3-dihydroisoindole-2-carboxylate;ethane;1-methylimidazole |
| SMILES | CC.COc1cc2c(cc1NC=O)CN(C(=O)OC(C)(C)C)C2.Cn1ccnc1 |
| InChI | InChI=1S/C15H20N2O4.C4H6N2.C2H6/c1-15(2,3)21-14(19)17-7-10-5-12(16-9-18)13(20-4)6-11(10)8-17;1-6-3-2-5-4-6;1-2/h5-6,9H,7-8H2,1-4H3,(H,16,18);2-4H,1H3;1-2H3 |
| InChIKey | LTSXBDFARXCZLI-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 85.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|