C13H20O — CID 162765333
(3E)-7-methyl-5-methylidene-4-propan-2-yloxyocta-1,3,7-triene (PubChem CID 162765333) has the molecular formula C13H20O and a molecular weight of 192.30 g/mol. Its IUPAC name is (3E)-7-methyl-5-methylidene-4-propan-2-yloxyocta-1,3,7-triene.
| Compound Name | (3E)-7-methyl-5-methylidene-4-propan-2-yloxyocta-1,3,7-triene |
|---|---|
| PubChem CID | 162765333 |
| Molecular Formula | C13H20O |
| Molecular Weight | 192.30 g/mol |
| Exact Mass | 192.15 |
| IUPAC Name | (3E)-7-methyl-5-methylidene-4-propan-2-yloxyocta-1,3,7-triene |
| SMILES | C=C/C=C(/OC(C)C)C(=C)CC(=C)C |
| InChI | InChI=1S/C13H20O/c1-7-8-13(14-11(4)5)12(6)9-10(2)3/h7-8,11H,1-2,6,9H2,3-5H3/b13-8+ |
| InChIKey | CAOODSWBHNILQJ-MDWZMJQESA-N |
| XLogP | 4.00 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.30 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|