C41H49FN6O3 — CID 162766664
1-[3-[8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-7-(3-hydroxynaphthalen-1-yl)quinazolin-4-yl]-3,8-diazabicyclo[3.2.1]octan-8-yl]-4-piperidin-1-ylbutan-1-one (PubChem CID 162766664) has the molecular formula C41H49FN6O3 and a molecular weight of 692.88 g/mol. Its IUPAC name is 1-[3-[8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-7-(3-hydroxynaphthalen-1-yl)quinazolin-4-yl]-3,8-diazabicyclo[3.2.1]octan-8-yl]-4-piperidin-1-ylbutan-1-one.
| Compound Name | 1-[3-[8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-7-(3-hydroxynaphthalen-1-yl)quinazolin-4-yl]-3,8-diazabicyclo[3.2.1]octan-8-yl]-4-piperidin-1-ylbutan-1-one |
|---|---|
| PubChem CID | 162766664 |
| Molecular Formula | C41H49FN6O3 |
| Molecular Weight | 692.88 g/mol |
| Exact Mass | 692.39 |
| IUPAC Name | 1-[3-[8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-7-(3-hydroxynaphthalen-1-yl)quinazolin-4-yl]-3,8-diazabicyclo[3.2.1]octan-8-yl]-4-piperidin-1-ylbutan-1-one |
| SMILES | O=C(CCCN1CCCCC1)N1C2CCC1CN(c1nc(OCC34CCCN3CCC4)nc3c(F)c(-c4cc(O)cc5ccccc45)ccc13)C2 |
| InChI | InChI=1S/C41H49FN6O3/c42-37-33(35-24-31(49)23-28-9-2-3-10-32(28)35)14-15-34-38(37)43-40(51-27-41-16-7-21-47(41)22-8-17-41)44-39(34)46-25-29-12-13-30(26-46)48(29)36(50)11-6-20-45-18-4-1-5-19-45/h2-3,9-10,14-15,23-24,29-30,49H,1,4-8,11-13,16-22,25-27H2 |
| InChIKey | RSTRZFGLRFVUPN-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 85.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.88 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |