C37H41N5O5 — CID 175854177
methyl 4-[(1R,5S)-3-[2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-7-(3-hydroxynaphthalen-1-yl)quinazolin-4-yl]-3,8-diazabicyclo[3.2.1]octan-8-yl]-4-oxobutanoate (PubChem CID 175854177) has the molecular formula C37H41N5O5 and a molecular weight of 635.77 g/mol. Its IUPAC name is methyl 4-[(1R,5S)-3-[2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-7-(3-hydroxynaphthalen-1-yl)quinazolin-4-yl]-3,8-diazabicyclo[3.2.1]octan-8-yl]-4-oxobutanoate.
| Compound Name | methyl 4-[(1R,5S)-3-[2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-7-(3-hydroxynaphthalen-1-yl)quinazolin-4-yl]-3,8-diazabicyclo[3.2.1]octan-8-yl]-4-oxobutanoate |
|---|---|
| PubChem CID | 175854177 |
| Molecular Formula | C37H41N5O5 |
| Molecular Weight | 635.77 g/mol |
| Exact Mass | 635.31 |
| IUPAC Name | methyl 4-[(1R,5S)-3-[2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-7-(3-hydroxynaphthalen-1-yl)quinazolin-4-yl]-3,8-diazabicyclo[3.2.1]octan-8-yl]-4-oxobutanoate |
| SMILES | COC(=O)CCC(=O)N1[C@@H]2CC[C@H]1CN(c1nc(OCC34CCCN3CCC4)nc3cc(-c4cc(O)cc5ccccc45)ccc13)C2 |
| InChI | InChI=1S/C37H41N5O5/c1-46-34(45)13-12-33(44)42-26-9-10-27(42)22-40(21-26)35-30-11-8-25(31-20-28(43)18-24-6-2-3-7-29(24)31)19-32(30)38-36(39-35)47-23-37-14-4-16-41(37)17-5-15-37/h2-3,6-8,11,18-20,26-27,43H,4-5,9-10,12-17,21-23H2,1H3/t26-,27+ |
| InChIKey | IKOVOPHWVQMDGN-MKPDMIMOSA-N |
| XLogP | 5.30 |
| TPSA | 108.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.77 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |