C38H40N6O2 — CID 167400223
4-[2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-4-[(1S,5R)-8-(pyridin-2-ylmethyl)-3,8-diazabicyclo[3.2.1]octan-3-yl]quinazolin-7-yl]naphthalen-2-ol (PubChem CID 167400223) has the molecular formula C38H40N6O2 and a molecular weight of 612.78 g/mol. Its IUPAC name is 4-[2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-4-[(1S,5R)-8-(pyridin-2-ylmethyl)-3,8-diazabicyclo[3.2.1]octan-3-yl]quinazolin-7-yl]naphthalen-2-ol.
| Compound Name | 4-[2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-4-[(1S,5R)-8-(pyridin-2-ylmethyl)-3,8-diazabicyclo[3.2.1]octan-3-yl]quinazolin-7-yl]naphthalen-2-ol |
|---|---|
| PubChem CID | 167400223 |
| Molecular Formula | C38H40N6O2 |
| Molecular Weight | 612.78 g/mol |
| Exact Mass | 612.32 |
| IUPAC Name | 4-[2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-4-[(1S,5R)-8-(pyridin-2-ylmethyl)-3,8-diazabicyclo[3.2.1]octan-3-yl]quinazolin-7-yl]naphthalen-2-ol |
| SMILES | Oc1cc(-c2ccc3c(N4C[C@H]5CC[C@@H](C4)N5Cc4ccccn4)nc(OCC45CCCN4CCC5)nc3c2)c2ccccc2c1 |
| InChI | InChI=1S/C38H40N6O2/c45-31-19-26-7-1-2-9-32(26)34(21-31)27-10-13-33-35(20-27)40-37(46-25-38-14-5-17-43(38)18-6-15-38)41-36(33)42-23-29-11-12-30(24-42)44(29)22-28-8-3-4-16-39-28/h1-4,7-10,13,16,19-21,29-30,45H,5-6,11-12,14-15,17-18,22-25H2/t29-,30+ |
| InChIKey | BKLFQPLROUKHFB-RNPORBBMSA-N |
| XLogP | 6.41 |
| TPSA | 77.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.78 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |