C35H36FN5O5 — CID 167400147
3-[(1R,5S)-3-[8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-7-(3-hydroxynaphthalen-1-yl)quinazolin-4-yl]-3,8-diazabicyclo[3.2.1]octan-8-yl]-3-oxopropanoic acid (PubChem CID 167400147) has the molecular formula C35H36FN5O5 and a molecular weight of 625.70 g/mol. Its IUPAC name is 3-[(1R,5S)-3-[8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-7-(3-hydroxynaphthalen-1-yl)quinazolin-4-yl]-3,8-diazabicyclo[3.2.1]octan-8-yl]-3-oxopropanoic acid.
| Compound Name | 3-[(1R,5S)-3-[8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-7-(3-hydroxynaphthalen-1-yl)quinazolin-4-yl]-3,8-diazabicyclo[3.2.1]octan-8-yl]-3-oxopropanoic acid |
|---|---|
| PubChem CID | 167400147 |
| Molecular Formula | C35H36FN5O5 |
| Molecular Weight | 625.70 g/mol |
| Exact Mass | 625.27 |
| IUPAC Name | 3-[(1R,5S)-3-[8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-7-(3-hydroxynaphthalen-1-yl)quinazolin-4-yl]-3,8-diazabicyclo[3.2.1]octan-8-yl]-3-oxopropanoic acid |
| SMILES | O=C(O)CC(=O)N1[C@@H]2CC[C@H]1CN(c1nc(OCC34CCCN3CCC4)nc3c(F)c(-c4cc(O)cc5ccccc45)ccc13)C2 |
| InChI | InChI=1S/C35H36FN5O5/c36-31-26(28-16-24(42)15-21-5-1-2-6-25(21)28)9-10-27-32(31)37-34(46-20-35-11-3-13-40(35)14-4-12-35)38-33(27)39-18-22-7-8-23(19-39)41(22)29(43)17-30(44)45/h1-2,5-6,9-10,15-16,22-23,42H,3-4,7-8,11-14,17-20H2,(H,44,45)/t22-,23+ |
| InChIKey | NFZOSXFSMXXWKR-ZRZAMGCNSA-N |
| XLogP | 4.96 |
| TPSA | 119.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.70 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|