C36H45N7O — CID 162766738
1-(1-adamantyl)-7-[4-(4-methylpiperazin-1-yl)anilino]-3-(2,3,4-trimethylphenyl)-4H-pyrimido[4,5-d]pyrimidin-2-one (PubChem CID 162766738) has the molecular formula C36H45N7O and a molecular weight of 591.80 g/mol. Its IUPAC name is 1-(1-adamantyl)-7-[4-(4-methylpiperazin-1-yl)anilino]-3-(2,3,4-trimethylphenyl)-4H-pyrimido[4,5-d]pyrimidin-2-one.
| Compound Name | 1-(1-adamantyl)-7-[4-(4-methylpiperazin-1-yl)anilino]-3-(2,3,4-trimethylphenyl)-4H-pyrimido[4,5-d]pyrimidin-2-one |
|---|---|
| PubChem CID | 162766738 |
| Molecular Formula | C36H45N7O |
| Molecular Weight | 591.80 g/mol |
| Exact Mass | 591.37 |
| IUPAC Name | 1-(1-adamantyl)-7-[4-(4-methylpiperazin-1-yl)anilino]-3-(2,3,4-trimethylphenyl)-4H-pyrimido[4,5-d]pyrimidin-2-one |
| SMILES | Cc1ccc(N2Cc3cnc(Nc4ccc(N5CCN(C)CC5)cc4)nc3N(C34CC5CC(CC(C5)C3)C4)C2=O)c(C)c1C |
| InChI | InChI=1S/C36H45N7O/c1-23-5-10-32(25(3)24(23)2)42-22-29-21-37-34(38-30-6-8-31(9-7-30)41-13-11-40(4)12-14-41)39-33(29)43(35(42)44)36-18-26-15-27(19-36)17-28(16-26)20-36/h5-10,21,26-28H,11-20,22H2,1-4H3,(H,37,38,39) |
| InChIKey | IMJRDFCVARFDIT-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 67.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.80 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|