C23H26N8S — CID 175746979
N-[4-(4-methylpiperazin-1-yl)phenyl]-7-thiophen-2-yl-2,5,7,11,13-pentazatricyclo[7.4.0.02,6]trideca-1(13),5,9,11-tetraen-12-amine (PubChem CID 175746979) has the molecular formula C23H26N8S and a molecular weight of 446.58 g/mol. Its IUPAC name is N-[4-(4-methylpiperazin-1-yl)phenyl]-7-thiophen-2-yl-2,5,7,11,13-pentazatricyclo[7.4.0.02,6]trideca-1(13),5,9,11-tetraen-12-amine.
| Compound Name | N-[4-(4-methylpiperazin-1-yl)phenyl]-7-thiophen-2-yl-2,5,7,11,13-pentazatricyclo[7.4.0.02,6]trideca-1(13),5,9,11-tetraen-12-amine |
|---|---|
| PubChem CID | 175746979 |
| Molecular Formula | C23H26N8S |
| Molecular Weight | 446.58 g/mol |
| Exact Mass | 446.20 |
| IUPAC Name | N-[4-(4-methylpiperazin-1-yl)phenyl]-7-thiophen-2-yl-2,5,7,11,13-pentazatricyclo[7.4.0.02,6]trideca-1(13),5,9,11-tetraen-12-amine |
| SMILES | CN1CCN(c2ccc(Nc3ncc4c(n3)N3CCN=C3N(c3cccs3)C4)cc2)CC1 |
| InChI | InChI=1S/C23H26N8S/c1-28-10-12-29(13-11-28)19-6-4-18(5-7-19)26-22-25-15-17-16-31(20-3-2-14-32-20)23-24-8-9-30(23)21(17)27-22/h2-7,14-15H,8-13,16H2,1H3,(H,25,26,27) |
| InChIKey | YZOIJDBMPQHLHX-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 63.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.58 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|