C30H38N4O5 — CID 162769898
(2S)-2-acetamido-N-(2-adamantyl)-5-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]pentanamide (PubChem CID 162769898) has the molecular formula C30H38N4O5 and a molecular weight of 534.66 g/mol. Its IUPAC name is (2S)-2-acetamido-N-(2-adamantyl)-5-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]pentanamide.
| Compound Name | (2S)-2-acetamido-N-(2-adamantyl)-5-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]pentanamide |
|---|---|
| PubChem CID | 162769898 |
| Molecular Formula | C30H38N4O5 |
| Molecular Weight | 534.66 g/mol |
| Exact Mass | 534.28 |
| IUPAC Name | (2S)-2-acetamido-N-(2-adamantyl)-5-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]pentanamide |
| SMILES | CC(=O)N[C@@H](CCCc1cccc2c1CN(C1CCC(=O)NC1=O)C2=O)C(=O)NC1C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C30H38N4O5/c1-16(35)31-24(28(37)33-27-20-11-17-10-18(13-20)14-21(27)12-17)7-3-5-19-4-2-6-22-23(19)15-34(30(22)39)25-8-9-26(36)32-29(25)38/h2,4,6,17-18,20-21,24-25,27H,3,5,7-15H2,1H3,(H,31,35)(H,33,37)(H,32,36,38)/t17?,18?,20?,21?,24-,25?,27?/m0/s1 |
| InChIKey | DVCMJXTZMUUADD-ZACSJRIESA-N |
| XLogP | 2.22 |
| TPSA | 124.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.66 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|