C9H18N2 — CID 162769979
3-(4-methylpentyl)-1,2-dihydroimidazole (PubChem CID 162769979) has the molecular formula C9H18N2 and a molecular weight of 154.26 g/mol. Its IUPAC name is 3-(4-methylpentyl)-1,2-dihydroimidazole.
| Compound Name | 3-(4-methylpentyl)-1,2-dihydroimidazole |
|---|---|
| PubChem CID | 162769979 |
| Molecular Formula | C9H18N2 |
| Molecular Weight | 154.26 g/mol |
| Exact Mass | 154.15 |
| IUPAC Name | 3-(4-methylpentyl)-1,2-dihydroimidazole |
| SMILES | CC(C)CCCN1C=CNC1 |
| InChI | InChI=1S/C9H18N2/c1-9(2)4-3-6-11-7-5-10-8-11/h5,7,9-10H,3-4,6,8H2,1-2H3 |
| InChIKey | CWJPHJUJMORYPZ-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.26 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |