C9H16N2 — CID 59091162
3-(cyclopentylmethyl)-1,2-dihydroimidazole (PubChem CID 59091162) has the molecular formula C9H16N2 and a molecular weight of 152.24 g/mol. Its IUPAC name is 3-(cyclopentylmethyl)-1,2-dihydroimidazole.
| Compound Name | 3-(cyclopentylmethyl)-1,2-dihydroimidazole |
|---|---|
| PubChem CID | 59091162 |
| Molecular Formula | C9H16N2 |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.13 |
| IUPAC Name | 3-(cyclopentylmethyl)-1,2-dihydroimidazole |
| SMILES | C1=CN(CC2CCCC2)CN1 |
| InChI | InChI=1S/C9H16N2/c1-2-4-9(3-1)7-11-6-5-10-8-11/h5-6,9-10H,1-4,7-8H2 |
| InChIKey | QVTVDJWNYQVZKV-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |