C10H20N2 — CID 90687471
3-(4-methylhexyl)-1,2-dihydroimidazole (PubChem CID 90687471) has the molecular formula C10H20N2 and a molecular weight of 168.28 g/mol. Its IUPAC name is 3-(4-methylhexyl)-1,2-dihydroimidazole.
| Compound Name | 3-(4-methylhexyl)-1,2-dihydroimidazole |
|---|---|
| PubChem CID | 90687471 |
| Molecular Formula | C10H20N2 |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.16 |
| IUPAC Name | 3-(4-methylhexyl)-1,2-dihydroimidazole |
| SMILES | CCC(C)CCCN1C=CNC1 |
| InChI | InChI=1S/C10H20N2/c1-3-10(2)5-4-7-12-8-6-11-9-12/h6,8,10-11H,3-5,7,9H2,1-2H3 |
| InChIKey | RMULZFCWOZUPPM-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |