C11H22N2 — CID 166971653
3-methyl-2-(4-methylhexyl)-1,2-dihydroimidazole (PubChem CID 166971653) has the molecular formula C11H22N2 and a molecular weight of 182.31 g/mol. Its IUPAC name is 3-methyl-2-(4-methylhexyl)-1,2-dihydroimidazole.
| Compound Name | 3-methyl-2-(4-methylhexyl)-1,2-dihydroimidazole |
|---|---|
| PubChem CID | 166971653 |
| Molecular Formula | C11H22N2 |
| Molecular Weight | 182.31 g/mol |
| Exact Mass | 182.18 |
| IUPAC Name | 3-methyl-2-(4-methylhexyl)-1,2-dihydroimidazole |
| SMILES | CCC(C)CCCC1NC=CN1C |
| InChI | InChI=1S/C11H22N2/c1-4-10(2)6-5-7-11-12-8-9-13(11)3/h8-12H,4-7H2,1-3H3 |
| InChIKey | VIQRISHIPZWBEO-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.31 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |