1-(2-ethylhexyl)-3-methyl-1,2-dihydroimidazol-1-ium chloride

C12H25ClN2 — CID 175222160

IUPAC1-(2-ethylhexyl)-3-methyl-1,2-dihydroimidazol-1-ium chloride
SMILESCCCCC(CC)C[NH+]1C=CN(C)C1.[Cl-]
InChIInChI=1S/C12H24N2.ClH/c1-4-6-7-12(5-2)10-14-9-8-13(3)11-14;/h8-9,12H,4-7,10-11H2,1-3H3;1H
InChIKeyIOROGNQISPBPDC-UHFFFAOYSA-N
MW232.80 g/mol
LogP-1.53
Rot. Bonds6

About 1-(2-ethylhexyl)-3-methyl-1,2-dihydroimidazol-1-ium chloride

1-(2-ethylhexyl)-3-methyl-1,2-dihydroimidazol-1-ium chloride (PubChem CID 175222160) has the molecular formula C12H25ClN2 and a molecular weight of 232.80 g/mol. Its IUPAC name is 1-(2-ethylhexyl)-3-methyl-1,2-dihydroimidazol-1-ium chloride.

Molecular Properties

Compound Name1-(2-ethylhexyl)-3-methyl-1,2-dihydroimidazol-1-ium chloride
PubChem CID175222160
Molecular FormulaC12H25ClN2
Molecular Weight232.80 g/mol
Exact Mass232.17
IUPAC Name1-(2-ethylhexyl)-3-methyl-1,2-dihydroimidazol-1-ium chloride
SMILESCCCCC(CC)C[NH+]1C=CN(C)C1.[Cl-]
InChIInChI=1S/C12H24N2.ClH/c1-4-6-7-12(5-2)10-14-9-8-13(3)11-14;/h8-9,12H,4-7,10-11H2,1-3H3;1H
InChIKeyIOROGNQISPBPDC-UHFFFAOYSA-N
XLogP-1.53
TPSA7.68 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds6
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500232.80
LogP ≤ 5-1.53
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Analyze 1-(2-ethylhexyl)-3-methyl-1,2-dihydroimidazol-1-ium chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-(2-ethylhexyl)-3-methyl-1,2-dihydroimidazol-1-ium chloride?
The IUPAC name of 1-(2-ethylhexyl)-3-methyl-1,2-dihydroimidazol-1-ium chloride (CID 175222160) is 1-(2-ethylhexyl)-3-methyl-1,2-dihydroimidazol-1-ium chloride.
What is the SMILES notation for 1-(2-ethylhexyl)-3-methyl-1,2-dihydroimidazol-1-ium chloride?
The canonical SMILES for 1-(2-ethylhexyl)-3-methyl-1,2-dihydroimidazol-1-ium chloride is CCCCC(CC)C[NH+]1C=CN(C)C1.[Cl-].
What is the InChIKey of 1-(2-ethylhexyl)-3-methyl-1,2-dihydroimidazol-1-ium chloride?
The InChIKey is IOROGNQISPBPDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24N2.ClH/c1-4-6-7-12(5-2)10-14-9-8-13(3)11-14;/h8-9,12H,4-7,10-11H2,1-3H3;1H.
What are the key properties of 1-(2-ethylhexyl)-3-methyl-1,2-dihydroimidazol-1-ium chloride?
1-(2-ethylhexyl)-3-methyl-1,2-dihydroimidazol-1-ium chloride has a molecular weight of 232.80 g/mol, XLogP of -1.53, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-ethylhexyl)-3-methyl-1,2-dihydroimidazol-1-ium chloride is sourced from PubChem (CID 175222160), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).