C12H25ClN2 — CID 175222160
1-(2-ethylhexyl)-3-methyl-1,2-dihydroimidazol-1-ium chloride (PubChem CID 175222160) has the molecular formula C12H25ClN2 and a molecular weight of 232.80 g/mol. Its IUPAC name is 1-(2-ethylhexyl)-3-methyl-1,2-dihydroimidazol-1-ium chloride.
| Compound Name | 1-(2-ethylhexyl)-3-methyl-1,2-dihydroimidazol-1-ium chloride |
|---|---|
| PubChem CID | 175222160 |
| Molecular Formula | C12H25ClN2 |
| Molecular Weight | 232.80 g/mol |
| Exact Mass | 232.17 |
| IUPAC Name | 1-(2-ethylhexyl)-3-methyl-1,2-dihydroimidazol-1-ium chloride |
| SMILES | CCCCC(CC)C[NH+]1C=CN(C)C1.[Cl-] |
| InChI | InChI=1S/C12H24N2.ClH/c1-4-6-7-12(5-2)10-14-9-8-13(3)11-14;/h8-9,12H,4-7,10-11H2,1-3H3;1H |
| InChIKey | IOROGNQISPBPDC-UHFFFAOYSA-N |
| XLogP | -1.53 |
| TPSA | 7.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.80 |
| LogP ≤ 5 | -1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |