C14H10N2O4 — CID 162769990
2-(3,4-dihydroxyphenyl)-1H-pyrido[1,2-a]pyrimidine-4,8-dione (PubChem CID 162769990) has the molecular formula C14H10N2O4 and a molecular weight of 270.24 g/mol. Its IUPAC name is 2-(3,4-dihydroxyphenyl)-1H-pyrido[1,2-a]pyrimidine-4,8-dione.
| Compound Name | 2-(3,4-dihydroxyphenyl)-1H-pyrido[1,2-a]pyrimidine-4,8-dione |
|---|---|
| PubChem CID | 162769990 |
| Molecular Formula | C14H10N2O4 |
| Molecular Weight | 270.24 g/mol |
| Exact Mass | 270.06 |
| IUPAC Name | 2-(3,4-dihydroxyphenyl)-1H-pyrido[1,2-a]pyrimidine-4,8-dione |
| SMILES | O=c1ccn2c(=O)cc(-c3ccc(O)c(O)c3)[nH]c2c1 |
| InChI | InChI=1S/C14H10N2O4/c17-9-3-4-16-13(6-9)15-10(7-14(16)20)8-1-2-11(18)12(19)5-8/h1-7,15,18-19H |
| InChIKey | YSRYWTXLXJAJQW-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 94.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.24 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|