C26H26N6O5 — CID 162770984
3-[7-[[1-(3-morpholin-4-ylphenyl)triazol-4-yl]methoxy]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 162770984) has the molecular formula C26H26N6O5 and a molecular weight of 502.53 g/mol. Its IUPAC name is 3-[7-[[1-(3-morpholin-4-ylphenyl)triazol-4-yl]methoxy]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[7-[[1-(3-morpholin-4-ylphenyl)triazol-4-yl]methoxy]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 162770984 |
| Molecular Formula | C26H26N6O5 |
| Molecular Weight | 502.53 g/mol |
| Exact Mass | 502.20 |
| IUPAC Name | 3-[7-[[1-(3-morpholin-4-ylphenyl)triazol-4-yl]methoxy]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3c(OCc4cn(-c5cccc(N6CCOCC6)c5)nn4)cccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C26H26N6O5/c33-24-8-7-22(25(34)27-24)31-15-21-20(26(31)35)5-2-6-23(21)37-16-17-14-32(29-28-17)19-4-1-3-18(13-19)30-9-11-36-12-10-30/h1-6,13-14,22H,7-12,15-16H2,(H,27,33,34) |
| InChIKey | VUOYOOYIRRJUEV-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 118.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.53 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|