C22H19Cl2N5O3 — CID 146635951
3-[4-[[1-(3,4-dichlorophenyl)triazol-4-yl]methoxy]-1,3-dihydroisoindol-2-yl]piperidine-2,6-dione (PubChem CID 146635951) has the molecular formula C22H19Cl2N5O3 and a molecular weight of 472.33 g/mol. Its IUPAC name is 3-[4-[[1-(3,4-dichlorophenyl)triazol-4-yl]methoxy]-1,3-dihydroisoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[4-[[1-(3,4-dichlorophenyl)triazol-4-yl]methoxy]-1,3-dihydroisoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 146635951 |
| Molecular Formula | C22H19Cl2N5O3 |
| Molecular Weight | 472.33 g/mol |
| Exact Mass | 471.09 |
| IUPAC Name | 3-[4-[[1-(3,4-dichlorophenyl)triazol-4-yl]methoxy]-1,3-dihydroisoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3cccc(OCc4cn(-c5ccc(Cl)c(Cl)c5)nn4)c3C2)C(=O)N1 |
| InChI | InChI=1S/C22H19Cl2N5O3/c23-17-5-4-15(8-18(17)24)29-10-14(26-27-29)12-32-20-3-1-2-13-9-28(11-16(13)20)19-6-7-21(30)25-22(19)31/h1-5,8,10,19H,6-7,9,11-12H2,(H,25,30,31) |
| InChIKey | OXLYTWKJDFNLFM-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 89.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.33 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|