C27H31N5O4 — CID 166794861
3-[7-[[1-(4,6-dimethyl-2-bicyclo[3.3.1]non-3-enyl)triazol-4-yl]methoxy]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 166794861) has the molecular formula C27H31N5O4 and a molecular weight of 489.58 g/mol. Its IUPAC name is 3-[7-[[1-(4,6-dimethyl-2-bicyclo[3.3.1]non-3-enyl)triazol-4-yl]methoxy]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[7-[[1-(4,6-dimethyl-2-bicyclo[3.3.1]non-3-enyl)triazol-4-yl]methoxy]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 166794861 |
| Molecular Formula | C27H31N5O4 |
| Molecular Weight | 489.58 g/mol |
| Exact Mass | 489.24 |
| IUPAC Name | 3-[7-[[1-(4,6-dimethyl-2-bicyclo[3.3.1]non-3-enyl)triazol-4-yl]methoxy]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | CC1=CC(n2cc(COc3cccc4c3CN(C3CCC(=O)NC3=O)C4=O)nn2)C2CCC(C)C1C2 |
| InChI | InChI=1S/C27H31N5O4/c1-15-6-7-17-11-20(15)16(2)10-23(17)32-12-18(29-30-32)14-36-24-5-3-4-19-21(24)13-31(27(19)35)22-8-9-25(33)28-26(22)34/h3-5,10,12,15,17,20,22-23H,6-9,11,13-14H2,1-2H3,(H,28,33,34) |
| InChIKey | VVRNWWHTTBREQY-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 106.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.58 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|