C96H108N2 — CID 162778340
1-N,6-N-bis[3-(3,5-ditert-butylphenyl)phenyl]-1-N,6-N-bis[4-(3,5-ditert-butylphenyl)phenyl]pyrene-1,6-diamine (PubChem CID 162778340) has the molecular formula C96H108N2 and a molecular weight of 1289.93 g/mol. Its IUPAC name is 1-N,6-N-bis[3-(3,5-ditert-butylphenyl)phenyl]-1-N,6-N-bis[4-(3,5-ditert-butylphenyl)phenyl]pyrene-1,6-diamine.
| Compound Name | 1-N,6-N-bis[3-(3,5-ditert-butylphenyl)phenyl]-1-N,6-N-bis[4-(3,5-ditert-butylphenyl)phenyl]pyrene-1,6-diamine |
|---|---|
| PubChem CID | 162778340 |
| Molecular Formula | C96H108N2 |
| Molecular Weight | 1289.93 g/mol |
| Exact Mass | 1288.85 |
| IUPAC Name | 1-N,6-N-bis[3-(3,5-ditert-butylphenyl)phenyl]-1-N,6-N-bis[4-(3,5-ditert-butylphenyl)phenyl]pyrene-1,6-diamine |
| SMILES | CC(C)(C)c1cc(-c2ccc(N(c3cccc(-c4cc(C(C)(C)C)cc(C(C)(C)C)c4)c3)c3ccc4ccc5c(N(c6ccc(-c7cc(C(C)(C)C)cc(C(C)(C)C)c7)cc6)c6cccc(-c7cc(C(C)(C)C)cc(C(C)(C)C)c7)c6)ccc6ccc3c4c65)cc2)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C96H108N2/c1-89(2,3)71-47-67(48-72(57-71)90(4,5)6)61-31-39-79(40-32-61)97(81-29-25-27-65(55-81)69-51-75(93(13,14)15)59-76(52-69)94(16,17)18)85-45-37-63-36-44-84-86(46-38-64-35-43-83(85)87(63)88(64)84)98(80-41-33-62(34-42-80)68-49-73(91(7,8)9)58-74(50-68)92(10,11)12)82-30-26-28-66(56-82)70-53-77(95(19,20)21)60-78(54-70)96(22,23)24/h25-60H,1-24H3 |
| InChIKey | CRRKTOKZENBGQN-UHFFFAOYSA-N |
| XLogP | 28.57 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 98 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1289.93 |
| LogP ≤ 5 | 28.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|