C27H31N9O4 — CID 162778825
4-[4-[(dimethylamino)methyl]-3-phenylpyrazol-1-yl]-N-(2-methoxy-6-morpholin-4-yl-5-nitro-3-pyridinyl)-5-methylpyrimidin-2-amine (PubChem CID 162778825) has the molecular formula C27H31N9O4 and a molecular weight of 545.60 g/mol. Its IUPAC name is 4-[4-[(dimethylamino)methyl]-3-phenylpyrazol-1-yl]-N-(2-methoxy-6-morpholin-4-yl-5-nitro-3-pyridinyl)-5-methylpyrimidin-2-amine.
| Compound Name | 4-[4-[(dimethylamino)methyl]-3-phenylpyrazol-1-yl]-N-(2-methoxy-6-morpholin-4-yl-5-nitro-3-pyridinyl)-5-methylpyrimidin-2-amine |
|---|---|
| PubChem CID | 162778825 |
| Molecular Formula | C27H31N9O4 |
| Molecular Weight | 545.60 g/mol |
| Exact Mass | 545.25 |
| IUPAC Name | 4-[4-[(dimethylamino)methyl]-3-phenylpyrazol-1-yl]-N-(2-methoxy-6-morpholin-4-yl-5-nitro-3-pyridinyl)-5-methylpyrimidin-2-amine |
| SMILES | COc1nc(N2CCOCC2)c([N+](=O)[O-])cc1Nc1ncc(C)c(-n2cc(CN(C)C)c(-c3ccccc3)n2)n1 |
| InChI | InChI=1S/C27H31N9O4/c1-18-15-28-27(29-21-14-22(36(37)38)25(30-26(21)39-4)34-10-12-40-13-11-34)31-24(18)35-17-20(16-33(2)3)23(32-35)19-8-6-5-7-9-19/h5-9,14-15,17H,10-13,16H2,1-4H3,(H,28,29,31) |
| InChIKey | DCVDOSLJGQEXMX-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 136.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.60 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|