C42H26N3O2Pt- — CID 162783058
4-[1-(2-phenylphenyl)-4-(3-pyridin-2-ylbenzene-2-id-1-yl)benzimidazol-2-yl]dibenzofuran-3-ol;platinum (PubChem CID 162783058) has the molecular formula C42H26N3O2Pt- and a molecular weight of 799.77 g/mol. Its IUPAC name is 4-[1-(2-phenylphenyl)-4-(3-pyridin-2-ylbenzene-2-id-1-yl)benzimidazol-2-yl]dibenzofuran-3-ol;platinum.
| Compound Name | 4-[1-(2-phenylphenyl)-4-(3-pyridin-2-ylbenzene-2-id-1-yl)benzimidazol-2-yl]dibenzofuran-3-ol;platinum |
|---|---|
| PubChem CID | 162783058 |
| Molecular Formula | C42H26N3O2Pt- |
| Molecular Weight | 799.77 g/mol |
| Exact Mass | 799.17 |
| IUPAC Name | 4-[1-(2-phenylphenyl)-4-(3-pyridin-2-ylbenzene-2-id-1-yl)benzimidazol-2-yl]dibenzofuran-3-ol;platinum |
| SMILES | Oc1ccc2c(oc3ccccc32)c1-c1nc2c(-c3[c-]c(-c4ccccn4)ccc3)cccc2n1-c1ccccc1-c1ccccc1.[Pt] |
| InChI | InChI=1S/C42H26N3O2.Pt/c46-37-24-23-33-32-17-5-7-22-38(32)47-41(33)39(37)42-44-40-31(28-14-10-15-29(26-28)34-19-8-9-25-43-34)18-11-21-36(40)45(42)35-20-6-4-16-30(35)27-12-2-1-3-13-27;/h1-25,46H;/q-1; |
| InChIKey | ZDSDQRHNNGSZDL-UHFFFAOYSA-N |
| XLogP | 10.49 |
| TPSA | 64.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 799.77 |
| LogP ≤ 5 | 10.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|