C58H42N3O2Pt- — CID 170543443
4-[4-[3-tert-butyl-5-(4-phenyl-2-pyridinyl)benzene-6-id-1-yl]-1-(2-phenylphenyl)benzimidazol-2-yl]-6-phenyldibenzofuran-3-ol;platinum (PubChem CID 170543443) has the molecular formula C58H42N3O2Pt- and a molecular weight of 1008.07 g/mol. Its IUPAC name is 4-[4-[3-tert-butyl-5-(4-phenyl-2-pyridinyl)benzene-6-id-1-yl]-1-(2-phenylphenyl)benzimidazol-2-yl]-6-phenyldibenzofuran-3-ol;platinum.
| Compound Name | 4-[4-[3-tert-butyl-5-(4-phenyl-2-pyridinyl)benzene-6-id-1-yl]-1-(2-phenylphenyl)benzimidazol-2-yl]-6-phenyldibenzofuran-3-ol;platinum |
|---|---|
| PubChem CID | 170543443 |
| Molecular Formula | C58H42N3O2Pt- |
| Molecular Weight | 1008.07 g/mol |
| Exact Mass | 1007.29 |
| IUPAC Name | 4-[4-[3-tert-butyl-5-(4-phenyl-2-pyridinyl)benzene-6-id-1-yl]-1-(2-phenylphenyl)benzimidazol-2-yl]-6-phenyldibenzofuran-3-ol;platinum |
| SMILES | CC(C)(C)c1cc(-c2cc(-c3ccccc3)ccn2)[c-]c(-c2cccc3c2nc(-c2c(O)ccc4c2oc2c(-c5ccccc5)cccc24)n3-c2ccccc2-c2ccccc2)c1.[Pt] |
| InChI | InChI=1S/C58H42N3O2.Pt/c1-58(2,3)43-34-41(33-42(35-43)49-36-40(31-32-59-49)37-17-7-4-8-18-37)45-24-16-28-51-54(45)60-57(61(51)50-27-14-13-23-44(50)38-19-9-5-10-20-38)53-52(62)30-29-48-47-26-15-25-46(55(47)63-56(48)53)39-21-11-6-12-22-39;/h4-32,34-36,62H,1-3H3;/q-1; |
| InChIKey | GQUYCHVAJWUNMH-UHFFFAOYSA-N |
| XLogP | 15.12 |
| TPSA | 64.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1008.07 |
| LogP ≤ 5 | 15.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|